Abstract: Pharmaceutical composition containing a combination of a non steroidal anti inflammatory drug and a colchicoside derivative, the active ingredients being present in the free state or in the form of a salt.
NA
| # | Name | Date |
|---|---|---|
| 1 | 5559-delnp-2011-GPA-(13-09-2011).pdf | 2011-09-13 |
| 1 | 5559-DELNP-2011.pdf | 2018-12-10 |
| 2 | 5559-DELNP-2011-AbandonedLetter.pdf | 2018-01-30 |
| 2 | 5559-delnp-2011-Correspondence-Others-(13-09-2011).pdf | 2011-09-13 |
| 3 | 5559-DELNP-2011-FER.pdf | 2017-07-04 |
| 3 | 5559-DELNP-2011-Correspondence-Others-(20-01-2012).pdf | 2012-01-20 |
| 4 | 5559-delnp-2011-Indian Pharmaceuticals Alliance-(04-07-2016).pdf | 2016-07-04 |
| 4 | 5559-DELNP-2011-Assignment-(20-01-2012).pdf | 2012-01-20 |
| 5 | 5559-delnp-2011-Pre-Grant Opposition-(04-02-2013).pdf | 2013-02-04 |
| 5 | 5559-DELNP-2011-Correspondence Others-(23-01-2012).pdf | 2012-01-23 |
| 6 | 5559-delnp-2011-Correspondence Others-(19-12-2012).pdf | 2012-12-19 |
| 6 | 5559-DELNP-2011-Assignment-(23-01-2012).pdf | 2012-01-23 |
| 7 | 5559-delnp-2011-Form-5.pdf | 2012-03-05 |
| 7 | 5559-delnp-2011-Form-18-(19-12-2012).pdf | 2012-12-19 |
| 8 | 5559-delnp-2011-Form-3.pdf | 2012-03-05 |
| 8 | 5559-delnp-2011-Abstract.pdf | 2012-03-05 |
| 9 | 5559-delnp-2011-Claims.pdf | 2012-03-05 |
| 9 | 5559-delnp-2011-Form-2.pdf | 2012-03-05 |
| 10 | 5559-delnp-2011-Correspondence Others.pdf | 2012-03-05 |
| 10 | 5559-delnp-2011-Form-1.pdf | 2012-03-05 |
| 11 | 5559-delnp-2011-Description (Complete).pdf | 2012-03-05 |
| 12 | 5559-delnp-2011-Correspondence Others.pdf | 2012-03-05 |
| 12 | 5559-delnp-2011-Form-1.pdf | 2012-03-05 |
| 13 | 5559-delnp-2011-Claims.pdf | 2012-03-05 |
| 13 | 5559-delnp-2011-Form-2.pdf | 2012-03-05 |
| 14 | 5559-delnp-2011-Abstract.pdf | 2012-03-05 |
| 14 | 5559-delnp-2011-Form-3.pdf | 2012-03-05 |
| 15 | 5559-delnp-2011-Form-18-(19-12-2012).pdf | 2012-12-19 |
| 15 | 5559-delnp-2011-Form-5.pdf | 2012-03-05 |
| 16 | 5559-DELNP-2011-Assignment-(23-01-2012).pdf | 2012-01-23 |
| 16 | 5559-delnp-2011-Correspondence Others-(19-12-2012).pdf | 2012-12-19 |
| 17 | 5559-DELNP-2011-Correspondence Others-(23-01-2012).pdf | 2012-01-23 |
| 17 | 5559-delnp-2011-Pre-Grant Opposition-(04-02-2013).pdf | 2013-02-04 |
| 18 | 5559-DELNP-2011-Assignment-(20-01-2012).pdf | 2012-01-20 |
| 18 | 5559-delnp-2011-Indian Pharmaceuticals Alliance-(04-07-2016).pdf | 2016-07-04 |
| 19 | 5559-DELNP-2011-FER.pdf | 2017-07-04 |
| 19 | 5559-DELNP-2011-Correspondence-Others-(20-01-2012).pdf | 2012-01-20 |
| 20 | 5559-delnp-2011-Correspondence-Others-(13-09-2011).pdf | 2011-09-13 |
| 20 | 5559-DELNP-2011-AbandonedLetter.pdf | 2018-01-30 |
| 21 | 5559-DELNP-2011.pdf | 2018-12-10 |
| 21 | 5559-delnp-2011-GPA-(13-09-2011).pdf | 2011-09-13 |
| 1 | ss5559_31-05-2017.pdf |