Abstract: To provide crystal forms of (3R, 4S)-7-hydroxymethyl-2,2,9-trimethyl-4-(phenethylamino)-3,4-dihydro-2H-pyrano[2,3-g]quinolin-3-ol that are excellent as a drug, and production methods thereof [MEANS FOR SOLVING THE PROBLEMS] Production methods including crystallizing (3R, 4S)-7-hydroxymethyl-2,2,9-trimethyl-4-(phenethylamino)-3,4-dihydro-2H-pyrano[2,3-g]quinolin-3-ol from an acetate ester solvent, an aliphatic hydrocarbon solvent, a nitrile solvent, an aromatic hydrocarbon solvent, a ketone solvent or an ether solvent, and crystal forms obtained according to the methods.
NA
| # | Name | Date |
|---|---|---|
| 1 | 8360-DELNP-2011-AbandonedLetter.pdf | 2018-08-06 |
| 1 | Abstract.jpg | 2012-04-06 |
| 2 | 8360-DELNP-2011-FER.pdf | 2017-08-31 |
| 2 | 8360-delnp-2011-Form-5.pdf | 2012-04-06 |
| 3 | 8360-delnp-2011-Pre-Grant Correspondance-(17-06-2013).pdf | 2013-06-17 |
| 3 | 8360-delnp-2011-Form-3.pdf | 2012-04-06 |
| 4 | 8360-delnp-2011-Pre-Grant Opposition-(17-06-2013).pdf | 2013-06-17 |
| 4 | 8360-delnp-2011-Form-2.pdf | 2012-04-06 |
| 5 | 8360-delnp-2011-Form-1.pdf | 2012-04-06 |
| 5 | 8360-delnp-2011-Correspondence-Others-(23-04-2013).pdf | 2013-04-23 |
| 6 | 8360-delnp-2011-Form-18-(23-04-2013).pdf | 2013-04-23 |
| 6 | 8360-delnp-2011-Drawings.pdf | 2012-04-06 |
| 7 | 8360-delnp-2011-Description (Complete).pdf | 2012-04-06 |
| 7 | 8360-delnp-2011-Correspondence Others-(12-12-2012).pdf | 2012-12-12 |
| 8 | 8360-delnp-2011-GPA-(12-12-2012).pdf | 2012-12-12 |
| 8 | 8360-delnp-2011-Correspondence Others.pdf | 2012-04-06 |
| 9 | 8360-delnp-2011-Abstract.pdf | 2012-04-06 |
| 9 | 8360-delnp-2011-Claims.pdf | 2012-04-06 |
| 10 | 8360-delnp-2011-Abstract.pdf | 2012-04-06 |
| 10 | 8360-delnp-2011-Claims.pdf | 2012-04-06 |
| 11 | 8360-delnp-2011-Correspondence Others.pdf | 2012-04-06 |
| 11 | 8360-delnp-2011-GPA-(12-12-2012).pdf | 2012-12-12 |
| 12 | 8360-delnp-2011-Correspondence Others-(12-12-2012).pdf | 2012-12-12 |
| 12 | 8360-delnp-2011-Description (Complete).pdf | 2012-04-06 |
| 13 | 8360-delnp-2011-Drawings.pdf | 2012-04-06 |
| 13 | 8360-delnp-2011-Form-18-(23-04-2013).pdf | 2013-04-23 |
| 14 | 8360-delnp-2011-Correspondence-Others-(23-04-2013).pdf | 2013-04-23 |
| 14 | 8360-delnp-2011-Form-1.pdf | 2012-04-06 |
| 15 | 8360-delnp-2011-Form-2.pdf | 2012-04-06 |
| 15 | 8360-delnp-2011-Pre-Grant Opposition-(17-06-2013).pdf | 2013-06-17 |
| 16 | 8360-delnp-2011-Form-3.pdf | 2012-04-06 |
| 16 | 8360-delnp-2011-Pre-Grant Correspondance-(17-06-2013).pdf | 2013-06-17 |
| 17 | 8360-DELNP-2011-FER.pdf | 2017-08-31 |
| 17 | 8360-delnp-2011-Form-5.pdf | 2012-04-06 |
| 18 | Abstract.jpg | 2012-04-06 |
| 18 | 8360-DELNP-2011-AbandonedLetter.pdf | 2018-08-06 |
| 1 | 8360_delnp_2011patseerstrategy_01-08-2017.pdf |