Abstract: Process for the preparation of elixir of herbal extract. Juice extracted from cleaned fresh herbal material or materials or the decoction (kwatha) obtained from cleaned and dried fresh herbal material or materials is fermented using a fermenting agent comprising Saccharomyces species along with sugar solution and decoction of raisins (Vitis vinifera) and complementary solvent such as water under stirring at 30˚C+/- 2˚C in a closed vessel. The weight ratio of the fermentation on completion thereof as indicated by absence of bubbling of carbon dioxide is arrested by inactivating the fermenting agent by heating the fermentation mixture at 65˚C +/- 2˚C. The elixir is separated from the fermentation mixture by filtration followed by addition of distillate of flavouring agent(s) to the elixir prior to bottling thereof.
| # | Name | Date |
|---|---|---|
| 1 | 5-mum-2005-pre-grant opposition(11-3-2007).pdf | 2018-08-09 |
| 2 | 5-mum-2005-form 3(4-1-2005).pdf | 2018-08-09 |
| 3 | 5-mum-2005-form 26(18-3-2005).pdf | 2018-08-09 |
| 4 | 5-mum-2005-form 2(title page)-(4-1-2005).pdf | 2018-08-09 |
| 5 | 5-mum-2005-form 2(4-1-2005).pdf | 2018-08-09 |
| 6 | 5-mum-2005-form 18(3-7-2006).pdf | 2018-08-09 |
| 7 | 5-mum-2005-form 1(18-3-2005).pdf | 2018-08-09 |
| 8 | 5-mum-2005-description(complete)-(4-1-2005).pdf | 2018-08-09 |
| 9 | 5-mum-2005-correspondence(ipo)-(9-8-2007).pdf | 2018-08-09 |
| 10 | 5-mum-2005-correspondence(ipo)-(22-6-2011).pdf | 2018-08-09 |
| 11 | 5-mum-2005-correspondence 2(8-1-2007).pdf | 2018-08-09 |
| 12 | 5-mum-2005-correspondence 1(12-2-2007).pdf | 2018-08-09 |
| 13 | 5-mum-2005-claims(4-1-2005).pdf | 2018-08-09 |
| 14 | 5-mum-2005-cancelled pages(18-3-2005).pdf | 2018-08-09 |
| 15 | 5-mum-2005-abstract(4-1-2005).pdf | 2018-08-09 |